C16H20BrNO3S — CID 119256202
1-[4-(4-bromophenyl)sulfanylbutanoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 119256202) has the molecular formula C16H20BrNO3S and a molecular weight of 386.31 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)sulfanylbutanoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(4-bromophenyl)sulfanylbutanoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119256202 |
| Molecular Formula | C16H20BrNO3S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-[4-(4-bromophenyl)sulfanylbutanoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)CCCSc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H20BrNO3S/c1-16(15(20)21)8-9-18(11-16)14(19)3-2-10-22-13-6-4-12(17)5-7-13/h4-7H,2-3,8-11H2,1H3,(H,20,21) |
| InChIKey | CNUZGGTWHZULKH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|