About 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid
3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 119258590) has the molecular formula C15H13FN2O4
and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 119258590 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1coc(-c2ccccc2)n1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C15H13FN2O4/c16-15(14(20)21)6-7-18(9-15)13(19)11-8-22-12(17-11)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,20,21) |
| InChIKey | AGZZBXGEHGHYNW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid (CID 119258590) is 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid is O=C(c1coc(-c2ccccc2)n1)N1CCC(F)(C(=O)O)C1.
What is the InChIKey of 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid?
The InChIKey is AGZZBXGEHGHYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2O4/c16-15(14(20)21)6-7-18(9-15)13(19)11-8-22-12(17-11)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,20,21).
What are the key properties of 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid?
3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid has a molecular weight of 304.28 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-(2-phenyl-1,3-oxazole-4-carbonyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119258590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).