About 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid
1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119259362) has the molecular formula C15H12ClFN2O3S
and a molecular weight of 354.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid |
| PubChem CID | 119259362 |
| Molecular Formula | C15H12ClFN2O3S |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1csc(-c2cccc(Cl)c2)n1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C15H12ClFN2O3S/c16-10-3-1-2-9(6-10)12-18-11(7-23-12)13(20)19-5-4-15(17,8-19)14(21)22/h1-3,6-7H,4-5,8H2,(H,21,22) |
| InChIKey | NFGTZNGUWIYFJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid (CID 119259362) is 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid is O=C(c1csc(-c2cccc(Cl)c2)n1)N1CCC(F)(C(=O)O)C1.
What is the InChIKey of 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid?
The InChIKey is NFGTZNGUWIYFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClFN2O3S/c16-10-3-1-2-9(6-10)12-18-11(7-23-12)13(20)19-5-4-15(17,8-19)14(21)22/h1-3,6-7H,4-5,8H2,(H,21,22).
What are the key properties of 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid?
1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid has a molecular weight of 354.79 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl]-3-fluoropyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119259362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).