C14H20ClFN2O — CID 119260930
1-(4-amino-3-methylpiperidin-1-yl)-2-(2-fluorophenyl)ethanone;hydrochloride (PubChem CID 119260930) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 1-(4-amino-3-methylpiperidin-1-yl)-2-(2-fluorophenyl)ethanone;hydrochloride.
| Compound Name | 1-(4-amino-3-methylpiperidin-1-yl)-2-(2-fluorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119260930 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-amino-3-methylpiperidin-1-yl)-2-(2-fluorophenyl)ethanone;hydrochloride |
| SMILES | CC1CN(C(=O)Cc2ccccc2F)CCC1N.Cl |
| InChI | InChI=1S/C14H19FN2O.ClH/c1-10-9-17(7-6-13(10)16)14(18)8-11-4-2-3-5-12(11)15;/h2-5,10,13H,6-9,16H2,1H3;1H |
| InChIKey | KGZFSWHXRDPQGJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |