C20H25ClN2O — CID 119261732
N,N-dibenzylpiperidine-3-carboxamide;hydrochloride (PubChem CID 119261732) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is N,N-dibenzylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | N,N-dibenzylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119261732 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N,N-dibenzylpiperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(C1CCCNC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O.ClH/c23-20(19-12-7-13-21-14-19)22(15-17-8-3-1-4-9-17)16-18-10-5-2-6-11-18;/h1-6,8-11,19,21H,7,12-16H2;1H |
| InChIKey | GPXCROMIOZHYIB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |