C13H18Cl2N2O — CID 119262099
N-(3-chloro-4-methylphenyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 119262099) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-chloro-4-methylphenyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119262099 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)C2CCCCN2)cc1Cl.Cl |
| InChI | InChI=1S/C13H17ClN2O.ClH/c1-9-5-6-10(8-11(9)14)16-13(17)12-4-2-3-7-15-12;/h5-6,8,12,15H,2-4,7H2,1H3,(H,16,17);1H |
| InChIKey | GSPIVTIJEMZYSP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |