C12H18ClN3O3S — CID 119263305
N-[(4-sulfamoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119263305) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is N-[(4-sulfamoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[(4-sulfamoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119263305 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[(4-sulfamoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccc(CNC(=O)C2CCCN2)cc1 |
| InChI | InChI=1S/C12H17N3O3S.ClH/c13-19(17,18)10-5-3-9(4-6-10)8-15-12(16)11-2-1-7-14-11;/h3-6,11,14H,1-2,7-8H2,(H,15,16)(H2,13,17,18);1H |
| InChIKey | LVQCVHBMRPBQIX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |