C12H19ClN2O2 — CID 119263924
4-amino-N-(2-ethoxyphenyl)butanamide;hydrochloride (PubChem CID 119263924) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-amino-N-(2-ethoxyphenyl)butanamide;hydrochloride.
| Compound Name | 4-amino-N-(2-ethoxyphenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119263924 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-amino-N-(2-ethoxyphenyl)butanamide;hydrochloride |
| SMILES | CCOc1ccccc1NC(=O)CCCN.Cl |
| InChI | InChI=1S/C12H18N2O2.ClH/c1-2-16-11-7-4-3-6-10(11)14-12(15)8-5-9-13;/h3-4,6-7H,2,5,8-9,13H2,1H3,(H,14,15);1H |
| InChIKey | NCVXFWDJOAWXTJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |