C18H29N3O3S — CID 119266647
2-amino-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 119266647) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-amino-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 2-amino-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 119266647 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-amino-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | CCCC(N)C(=O)N1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O3S/c1-4-5-17(19)18(22)20-10-12-21(13-11-20)25(23,24)16-8-6-15(7-9-16)14(2)3/h6-9,14,17H,4-5,10-13,19H2,1-3H3 |
| InChIKey | MBLDWUNXCZFIHJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |