C13H21ClN2O2 — CID 119266766
(2R)-2-amino-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide;hydrochloride (PubChem CID 119266766) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is (2R)-2-amino-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119266766 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2R)-2-amino-N-[(4-ethoxyphenyl)methyl]-N-methylpropanamide;hydrochloride |
| SMILES | CCOc1ccc(CN(C)C(=O)[C@@H](C)N)cc1.Cl |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-4-17-12-7-5-11(6-8-12)9-15(3)13(16)10(2)14;/h5-8,10H,4,9,14H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | WCFVQJVPQNRMGG-HNCPQSOCSA-N |
| XLogP | 1.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |