About 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride
4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride (PubChem CID 119267084) has the molecular formula C8H14ClN3O2S
and a molecular weight of 251.74 g/mol. Its IUPAC name is 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride |
| PubChem CID | 119267084 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride |
| SMILES | Cl.O=C1CN(C(=O)[C@H]2CSCN2)CCN1 |
| InChI | InChI=1S/C8H13N3O2S.ClH/c12-7-3-11(2-1-9-7)8(13)6-4-14-5-10-6;/h6,10H,1-5H2,(H,9,12);1H/t6-;/m1./s1 |
| InChIKey | MVZLHUIUAUNYSI-FYZOBXCZSA-N |
| XLogP | -0.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride?
The IUPAC name of 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride (CID 119267084) is 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride.
What is the SMILES notation for 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride?
The canonical SMILES for 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride is Cl.O=C1CN(C(=O)[C@H]2CSCN2)CCN1.
What is the InChIKey of 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride?
The InChIKey is MVZLHUIUAUNYSI-FYZOBXCZSA-N. The full InChI is InChI=1S/C8H13N3O2S.ClH/c12-7-3-11(2-1-9-7)8(13)6-4-14-5-10-6;/h6,10H,1-5H2,(H,9,12);1H/t6-;/m1./s1.
What are the key properties of 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride?
4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride has a molecular weight of 251.74 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-1,3-thiazolidine-4-carbonyl]piperazin-2-one;hydrochloride is sourced from PubChem (CID 119267084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).