About 7-methylquinoline
7-methylquinoline (PubChem CID 11927) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 7-methylquinoline.
Molecular Properties
| Compound Name | 7-methylquinoline |
| PubChem CID | 11927 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 7-methylquinoline |
| SMILES | Cc1ccc2cccnc2c1 |
| InChI | InChI=1S/C10H9N/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-7H,1H3 |
| InChIKey | KDYVCOSVYOSHOL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylquinoline?
The IUPAC name of 7-methylquinoline (CID 11927) is 7-methylquinoline.
What is the SMILES notation for 7-methylquinoline?
The canonical SMILES for 7-methylquinoline is Cc1ccc2cccnc2c1.
What is the InChIKey of 7-methylquinoline?
The InChIKey is KDYVCOSVYOSHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-7H,1H3.
What are the key properties of 7-methylquinoline?
7-methylquinoline has a molecular weight of 143.19 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylquinoline is sourced from PubChem (CID 11927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).