C12H19ClN2O — CID 119270636
(2S)-2-amino-N-[(2-methylphenyl)methyl]butanamide;hydrochloride (PubChem CID 119270636) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2-methylphenyl)methyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(2-methylphenyl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119270636 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2S)-2-amino-N-[(2-methylphenyl)methyl]butanamide;hydrochloride |
| SMILES | CC[C@H](N)C(=O)NCc1ccccc1C.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-3-11(13)12(15)14-8-10-7-5-4-6-9(10)2;/h4-7,11H,3,8,13H2,1-2H3,(H,14,15);1H/t11-;/m0./s1 |
| InChIKey | LOGIPFPGFNOZFN-MERQFXBCSA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |