C17H23N3O2 — CID 119271757
N-(1-acetyl-2,3-dihydroindol-5-yl)-1-aminocyclohexane-1-carboxamide (PubChem CID 119271757) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-1-aminocyclohexane-1-carboxamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-1-aminocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119271757 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-1-aminocyclohexane-1-carboxamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)C3(N)CCCCC3)ccc21 |
| InChI | InChI=1S/C17H23N3O2/c1-12(21)20-10-7-13-11-14(5-6-15(13)20)19-16(22)17(18)8-3-2-4-9-17/h5-6,11H,2-4,7-10,18H2,1H3,(H,19,22) |
| InChIKey | YAWCLUXNYYLMQZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |