C16H21N5O — CID 119271899
N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]piperidine-3-carboxamide (PubChem CID 119271899) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]piperidine-3-carboxamide.
| Compound Name | N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119271899 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]piperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCCNC1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-12(20-16(22)14-3-2-8-17-9-14)13-4-6-15(7-5-13)21-11-18-10-19-21/h4-7,10-12,14,17H,2-3,8-9H2,1H3,(H,20,22) |
| InChIKey | FVVYCYOPNREUGY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |