C21H19NO4S — CID 11927219
[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11927219) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927219 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1[S@](C)=O)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19NO4S/c1-14(26-21(24)18-9-5-6-10-19(18)27(2)25)20(23)22-17-12-11-15-7-3-4-8-16(15)13-17/h3-14H,1-2H3,(H,22,23)/t14-,27+/m1/s1 |
| InChIKey | NFNHXLBLCMGRTC-ASHKIFAZSA-N |
| XLogP | 3.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |