C15H22Cl2N2O2 — CID 119274437
N-[2-(2-chlorophenoxy)ethyl]-N-methylpiperidine-3-carboxamide;hydrochloride (PubChem CID 119274437) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-N-methylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-N-methylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119274437 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-N-methylpiperidine-3-carboxamide;hydrochloride |
| SMILES | CN(CCOc1ccccc1Cl)C(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C15H21ClN2O2.ClH/c1-18(15(19)12-5-4-8-17-11-12)9-10-20-14-7-3-2-6-13(14)16;/h2-3,6-7,12,17H,4-5,8-11H2,1H3;1H |
| InChIKey | AQJSZHWNIPYFGL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |