C18H27N3O4S — CID 119275548
N-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 119275548) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119275548 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1CS(=O)(=O)N1CCOCC1)C1CCNCC1 |
| InChI | InChI=1S/C18H27N3O4S/c22-18(15-5-7-19-8-6-15)20-13-16-3-1-2-4-17(16)14-26(23,24)21-9-11-25-12-10-21/h1-4,15,19H,5-14H2,(H,20,22) |
| InChIKey | LIDUYIKNYJGEJI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |