C19H28N2O — CID 119275906
[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-pyrrolidin-2-ylmethanone (PubChem CID 119275906) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is [4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-pyrrolidin-2-ylmethanone.
| Compound Name | [4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 119275906 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | [4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]-pyrrolidin-2-ylmethanone |
| SMILES | Cc1ccc(CCC2CCN(C(=O)C3CCCN3)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O/c1-15-4-6-16(7-5-15)8-9-17-10-13-21(14-11-17)19(22)18-3-2-12-20-18/h4-7,17-18,20H,2-3,8-14H2,1H3 |
| InChIKey | DQCZOIXZCMVLCU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |