C22H31ClN2O3 — CID 119276781
(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-piperidin-4-ylmethanone;hydrochloride (PubChem CID 119276781) has the molecular formula C22H31ClN2O3 and a molecular weight of 406.95 g/mol. Its IUPAC name is (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-piperidin-4-ylmethanone;hydrochloride.
| Compound Name | (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-piperidin-4-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119276781 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-piperidin-4-ylmethanone;hydrochloride |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)C1CCNCC1)OCCO3.Cl |
| InChI | InChI=1S/C22H30N2O3.ClH/c1-15-17-12-19-20(27-11-10-26-19)13-18(17)22(6-2-3-7-22)14-24(15)21(25)16-4-8-23-9-5-16;/h12-13,15-16,23H,2-11,14H2,1H3;1H |
| InChIKey | NHCCSINMKXBYRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |