C24H16N2O4 — CID 1192787
16-(pyridin-2-ylmethyl)-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione (PubChem CID 1192787) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is 16-(pyridin-2-ylmethyl)-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione.
| Compound Name | 16-(pyridin-2-ylmethyl)-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
|---|---|
| PubChem CID | 1192787 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 16-(pyridin-2-ylmethyl)-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1c3c(ccc21)OCN(Cc1ccccn1)C3 |
| InChI | InChI=1S/C24H16N2O4/c27-21-15-6-1-2-7-16(15)22(28)24-20(21)17-8-9-19-18(23(17)30-24)12-26(13-29-19)11-14-5-3-4-10-25-14/h1-10H,11-13H2 |
| InChIKey | RGCDNJSMYYQKOU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|