C20H26ClN3O2 — CID 119278732
N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-3-methylbutanamide;hydrochloride (PubChem CID 119278732) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-3-methylbutanamide;hydrochloride.
| Compound Name | N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119278732 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[4-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)[C@@H](N)Cc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25N3O2.ClH/c1-14(2)12-19(24)22-16-8-10-17(11-9-16)23-20(25)18(21)13-15-6-4-3-5-7-15;/h3-11,14,18H,12-13,21H2,1-2H3,(H,22,24)(H,23,25);1H/t18-;/m0./s1 |
| InChIKey | QIHNQZSJLHXFBV-FERBBOLQSA-N |
| XLogP | 3.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |