C15H23ClN2O2 — CID 119278882
N-(2-methoxy-2-phenylethyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 119278882) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is N-(2-methoxy-2-phenylethyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-(2-methoxy-2-phenylethyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119278882 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(2-methoxy-2-phenylethyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | COC(CNC(=O)C1CCCCN1)c1ccccc1.Cl |
| InChI | InChI=1S/C15H22N2O2.ClH/c1-19-14(12-7-3-2-4-8-12)11-17-15(18)13-9-5-6-10-16-13;/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3,(H,17,18);1H |
| InChIKey | VICCQMJUROOYGZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |