About ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride
ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride (PubChem CID 119279987) has the molecular formula C8H15ClN2O3S
and a molecular weight of 254.74 g/mol. Its IUPAC name is ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride |
| PubChem CID | 119279987 |
| Molecular Formula | C8H15ClN2O3S |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride |
| SMILES | CCOC(=O)CNC(=O)[C@H]1CSCN1.Cl |
| InChI | InChI=1S/C8H14N2O3S.ClH/c1-2-13-7(11)3-9-8(12)6-4-14-5-10-6;/h6,10H,2-5H2,1H3,(H,9,12);1H/t6-;/m1./s1 |
| InChIKey | KBXAUWPEKBZJAB-FYZOBXCZSA-N |
| XLogP | -0.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride?
The IUPAC name of ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride (CID 119279987) is ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride.
What is the SMILES notation for ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride?
The canonical SMILES for ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride is CCOC(=O)CNC(=O)[C@H]1CSCN1.Cl.
What is the InChIKey of ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride?
The InChIKey is KBXAUWPEKBZJAB-FYZOBXCZSA-N. The full InChI is InChI=1S/C8H14N2O3S.ClH/c1-2-13-7(11)3-9-8(12)6-4-14-5-10-6;/h6,10H,2-5H2,1H3,(H,9,12);1H/t6-;/m1./s1.
What are the key properties of ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride?
ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride has a molecular weight of 254.74 g/mol, XLogP of -0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(4S)-1,3-thiazolidine-4-carbonyl]amino]acetate;hydrochloride is sourced from PubChem (CID 119279987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).