C16H23N3O2 — CID 119282271
(2S)-2-amino-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 119282271) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | (2S)-2-amino-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119282271 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2S)-2-amino-1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | Cc1cccc(C(=O)N2CCCN(C(=O)[C@H](C)N)CC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-12-5-3-6-14(11-12)16(21)19-8-4-7-18(9-10-19)15(20)13(2)17/h3,5-6,11,13H,4,7-10,17H2,1-2H3/t13-/m0/s1 |
| InChIKey | CWYMSQGEZWTTGL-ZDUSSCGKSA-N |
| XLogP | 1.02 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |