C19H19Cl2N3O2 — CID 119287873
2-amino-1-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-phenylethanone (PubChem CID 119287873) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-amino-1-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-amino-1-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 119287873 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-amino-1-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-phenylethanone |
| SMILES | NC(C(=O)N1CCN(C(=O)c2cccc(Cl)c2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-15-8-4-7-14(16(15)21)18(25)23-9-11-24(12-10-23)19(26)17(22)13-5-2-1-3-6-13/h1-8,17H,9-12,22H2 |
| InChIKey | HBWISXURXVUSIG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |