C20H31ClN2O — CID 119288433
[2-(4-tert-butylphenyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride (PubChem CID 119288433) has the molecular formula C20H31ClN2O and a molecular weight of 350.93 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride.
| Compound Name | [2-(4-tert-butylphenyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119288433 |
| Molecular Formula | C20H31ClN2O |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [2-(4-tert-butylphenyl)pyrrolidin-1-yl]-piperidin-3-ylmethanone;hydrochloride |
| SMILES | CC(C)(C)c1ccc(C2CCCN2C(=O)C2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C20H30N2O.ClH/c1-20(2,3)17-10-8-15(9-11-17)18-7-5-13-22(18)19(23)16-6-4-12-21-14-16;/h8-11,16,18,21H,4-7,12-14H2,1-3H3;1H |
| InChIKey | TYLMKSHBAJNHEE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |