C11H17ClN2O2 — CID 119288747
(2R)-2-amino-N-[2-(methoxymethyl)phenyl]propanamide;hydrochloride (PubChem CID 119288747) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(methoxymethyl)phenyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[2-(methoxymethyl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119288747 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2R)-2-amino-N-[2-(methoxymethyl)phenyl]propanamide;hydrochloride |
| SMILES | COCc1ccccc1NC(=O)[C@@H](C)N.Cl |
| InChI | InChI=1S/C11H16N2O2.ClH/c1-8(12)11(14)13-10-6-4-3-5-9(10)7-15-2;/h3-6,8H,7,12H2,1-2H3,(H,13,14);1H/t8-;/m1./s1 |
| InChIKey | RVGLUKTUUMPSNP-DDWIOCJRSA-N |
| XLogP | 1.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |