C21H24ClN3O2 — CID 119289657
N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119289657) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119289657 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(=O)n(Cc2ccccc2Cl)c1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-17-7-3-1-6-15(17)12-25-13-16(9-10-20(25)26)23-21(27)19-11-14-5-2-4-8-18(14)24-19/h1,3,6-7,9-10,13-14,18-19,24H,2,4-5,8,11-12H2,(H,23,27) |
| InChIKey | QHNBWSHOUSCYSH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |