C17H24ClN3O3 — CID 119290061
N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119290061) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119290061 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CCCCN2)cc1N1CCCC1=O.Cl |
| InChI | InChI=1S/C17H23N3O3.ClH/c1-23-15-8-7-12(11-14(15)20-10-4-6-16(20)21)19-17(22)13-5-2-3-9-18-13;/h7-8,11,13,18H,2-6,9-10H2,1H3,(H,19,22);1H |
| InChIKey | JQPBJTCORQXOIT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |