C19H25NO4 — CID 11929122
[2-oxo-2-(2-phenoxyethylamino)ethyl] 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11929122) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11929122 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C[C@H]2CC[C@@H]1C2)NCCOc1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c21-18(20-8-9-23-17-4-2-1-3-5-17)13-24-19(22)12-16-11-14-6-7-15(16)10-14/h1-5,14-16H,6-13H2,(H,20,21)/t14-,15+,16+/m0/s1 |
| InChIKey | LUYLSWPQAQPOLX-ARFHVFGLSA-N |
| XLogP | 2.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|