C19H22N2O4 — CID 119292475
2-amino-N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]pentanamide (PubChem CID 119292475) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-amino-N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]pentanamide.
| Compound Name | 2-amino-N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 119292475 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-amino-N-[3-(1,3-benzodioxol-5-yloxymethyl)phenyl]pentanamide |
| SMILES | CCCC(N)C(=O)Nc1cccc(COc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-4-16(20)19(22)21-14-6-3-5-13(9-14)11-23-15-7-8-17-18(10-15)25-12-24-17/h3,5-10,16H,2,4,11-12,20H2,1H3,(H,21,22) |
| InChIKey | PBWVKWCPYZCNFG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |