C17H23N3O2 — CID 119292758
N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperidine-2-carboxamide (PubChem CID 119292758) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperidine-2-carboxamide.
| Compound Name | N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119292758 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCCCN1)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H23N3O2/c1-11(19-17(22)15-4-2-3-9-18-15)12-5-7-14-13(10-12)6-8-16(21)20-14/h5,7,10-11,15,18H,2-4,6,8-9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | JTICZWAIBZRQRA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |