About 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride
2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride (PubChem CID 119293291) has the molecular formula C14H19ClN2O2
and a molecular weight of 282.77 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride |
| PubChem CID | 119293291 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCNCC1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C14H18N2O2.ClH/c17-14(11-5-7-15-8-6-11)16-9-10-18-13-4-2-1-3-12(13)16;/h1-4,11,15H,5-10H2;1H |
| InChIKey | NRMOZBZDROISIC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride?
The IUPAC name of 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride (CID 119293291) is 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride.
What is the SMILES notation for 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride?
The canonical SMILES for 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride is Cl.O=C(C1CCNCC1)N1CCOc2ccccc21.
What is the InChIKey of 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride?
The InChIKey is NRMOZBZDROISIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2.ClH/c17-14(11-5-7-15-8-6-11)16-9-10-18-13-4-2-1-3-12(13)16;/h1-4,11,15H,5-10H2;1H.
What are the key properties of 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride?
2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride has a molecular weight of 282.77 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzoxazin-4-yl(piperidin-4-yl)methanone;hydrochloride is sourced from PubChem (CID 119293291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).