C12H18ClN3O2S — CID 119298879
(2S)-2-amino-1-[4-(thiophene-3-carbonyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 119298879) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(thiophene-3-carbonyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | (2S)-2-amino-1-[4-(thiophene-3-carbonyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119298879 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S)-2-amino-1-[4-(thiophene-3-carbonyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | C[C@H](N)C(=O)N1CCN(C(=O)c2ccsc2)CC1.Cl |
| InChI | InChI=1S/C12H17N3O2S.ClH/c1-9(13)11(16)14-3-5-15(6-4-14)12(17)10-2-7-18-8-10;/h2,7-9H,3-6,13H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | YPCWZRSAACYTKC-FVGYRXGTSA-N |
| XLogP | 0.80 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |