C18H26ClN3O2 — CID 119299320
N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119299320) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119299320 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[[3-(cyclopentanecarbonylamino)phenyl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(CNC(=O)C2CCCN2)c1)C1CCCC1 |
| InChI | InChI=1S/C18H25N3O2.ClH/c22-17(14-6-1-2-7-14)21-15-8-3-5-13(11-15)12-20-18(23)16-9-4-10-19-16;/h3,5,8,11,14,16,19H,1-2,4,6-7,9-10,12H2,(H,20,23)(H,21,22);1H |
| InChIKey | SGDIXCRNORCGAC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |