C14H26ClN3O2 — CID 119299488
N-[3-(cyclohexylamino)-3-oxopropyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119299488) has the molecular formula C14H26ClN3O2 and a molecular weight of 303.83 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)-3-oxopropyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(cyclohexylamino)-3-oxopropyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119299488 |
| Molecular Formula | C14H26ClN3O2 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[3-(cyclohexylamino)-3-oxopropyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(CCNC(=O)C1CCCN1)NC1CCCCC1 |
| InChI | InChI=1S/C14H25N3O2.ClH/c18-13(17-11-5-2-1-3-6-11)8-10-16-14(19)12-7-4-9-15-12;/h11-12,15H,1-10H2,(H,16,19)(H,17,18);1H |
| InChIKey | DEADHGQNSQJLLO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |