C13H19N3OS2 — CID 119300541
N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 119300541) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119300541 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCCCC2)C1CSCN1 |
| InChI | InChI=1S/C13H19N3OS2/c17-12(10-7-18-8-14-10)16-13-15-9-5-3-1-2-4-6-11(9)19-13/h10,14H,1-8H2,(H,15,16,17) |
| InChIKey | PBXVEAPDKOHNPO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |