C10H13FN2O2 — CID 119301146
2-amino-N-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]acetamide (PubChem CID 119301146) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-amino-N-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 119301146 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-amino-N-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]acetamide |
| SMILES | NCC(=O)NCc1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C10H13FN2O2/c11-9-3-7(1-2-8(9)6-14)5-13-10(15)4-12/h1-3,14H,4-6,12H2,(H,13,15) |
| InChIKey | RCOIKJMDCNDCJX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |