About (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone
(1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone (PubChem CID 119302371) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone.
Molecular Properties
| Compound Name | (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone |
| PubChem CID | 119302371 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone |
| SMILES | NC1(C(=O)N2CC3CC4CC(C3)CC2C4)CCCCC1 |
| InChI | InChI=1S/C17H28N2O/c18-17(4-2-1-3-5-17)16(20)19-11-14-7-12-6-13(8-14)10-15(19)9-12/h12-15H,1-11,18H2 |
| InChIKey | DZIPASKEPMPETM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone?
The IUPAC name of (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone (CID 119302371) is (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone.
What is the SMILES notation for (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone?
The canonical SMILES for (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone is NC1(C(=O)N2CC3CC4CC(C3)CC2C4)CCCCC1.
What is the InChIKey of (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone?
The InChIKey is DZIPASKEPMPETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c18-17(4-2-1-3-5-17)16(20)19-11-14-7-12-6-13(8-14)10-15(19)9-12/h12-15H,1-11,18H2.
What are the key properties of (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone?
(1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone has a molecular weight of 276.42 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclohexyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone is sourced from PubChem (CID 119302371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).