C19H35ClN4O2 — CID 119304292
1-[1-(1-aminocyclohexanecarbonyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride (PubChem CID 119304292) has the molecular formula C19H35ClN4O2 and a molecular weight of 386.97 g/mol. Its IUPAC name is 1-[1-(1-aminocyclohexanecarbonyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[1-(1-aminocyclohexanecarbonyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119304292 |
| Molecular Formula | C19H35ClN4O2 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-[1-(1-aminocyclohexanecarbonyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride |
| SMILES | Cl.NC1(C(=O)N2CCC(NC(=O)NC3CCCCC3)CC2)CCCCC1 |
| InChI | InChI=1S/C19H34N4O2.ClH/c20-19(11-5-2-6-12-19)17(24)23-13-9-16(10-14-23)22-18(25)21-15-7-3-1-4-8-15;/h15-16H,1-14,20H2,(H2,21,22,25);1H |
| InChIKey | ITYJBKIBTNQSTN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |