C16H29ClN2O2 — CID 119304301
N-ethyl-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119304301) has the molecular formula C16H29ClN2O2 and a molecular weight of 316.87 g/mol. Its IUPAC name is N-ethyl-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-ethyl-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119304301 |
| Molecular Formula | C16H29ClN2O2 |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-ethyl-N-(oxolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCN(CC1CCCO1)C(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C16H28N2O2.ClH/c1-2-18(11-13-7-5-9-20-13)16(19)15-10-12-6-3-4-8-14(12)17-15;/h12-15,17H,2-11H2,1H3;1H |
| InChIKey | VPWBTBDXAKECNM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |