C15H25ClN2OS — CID 119304582
N-[(5-methylthiophen-2-yl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119304582) has the molecular formula C15H25ClN2OS and a molecular weight of 316.90 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119304582 |
| Molecular Formula | C15H25ClN2OS |
| Molecular Weight | 316.90 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-N-propan-2-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(CN(C(=O)C2CCNCC2)C(C)C)s1.Cl |
| InChI | InChI=1S/C15H24N2OS.ClH/c1-11(2)17(10-14-5-4-12(3)19-14)15(18)13-6-8-16-9-7-13;/h4-5,11,13,16H,6-10H2,1-3H3;1H |
| InChIKey | XGZNAUKEOVEUQH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |