C14H23ClN4O — CID 119305621
N-(2-tert-butylpyrimidin-5-yl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119305621) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is N-(2-tert-butylpyrimidin-5-yl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(2-tert-butylpyrimidin-5-yl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119305621 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-(2-tert-butylpyrimidin-5-yl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)(C)c1ncc(NC(=O)C2CCNCC2)cn1.Cl |
| InChI | InChI=1S/C14H22N4O.ClH/c1-14(2,3)13-16-8-11(9-17-13)18-12(19)10-4-6-15-7-5-10;/h8-10,15H,4-7H2,1-3H3,(H,18,19);1H |
| InChIKey | HDKCHMXDEYTZLB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |