C19H22N2O4S — CID 11930636
ethyl (6S)-6-(4-methoxycarbonylphenyl)-4-methyl-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 11930636) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is ethyl (6S)-6-(4-methoxycarbonylphenyl)-4-methyl-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6S)-6-(4-methoxycarbonylphenyl)-4-methyl-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11930636 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl (6S)-6-(4-methoxycarbonylphenyl)-4-methyl-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CCN1C(=S)N[C@@H](c2ccc(C(=O)OC)cc2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C19H22N2O4S/c1-5-11-21-12(3)15(18(23)25-6-2)16(20-19(21)26)13-7-9-14(10-8-13)17(22)24-4/h5,7-10,16H,1,6,11H2,2-4H3,(H,20,26)/t16-/m0/s1 |
| InChIKey | DQBDFWTZOYMCNH-INIZCTEOSA-N |
| XLogP | 2.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|