C23H27N3O2S — CID 11930637
(6R)-N,N-diethyl-3-(2-methoxyphenyl)-4-methyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 11930637) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is (6R)-N,N-diethyl-3-(2-methoxyphenyl)-4-methyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6R)-N,N-diethyl-3-(2-methoxyphenyl)-4-methyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11930637 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (6R)-N,N-diethyl-3-(2-methoxyphenyl)-4-methyl-6-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N(c2ccccc2OC)C(=S)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-5-25(6-2)22(27)20-16(3)26(18-14-10-11-15-19(18)28-4)23(29)24-21(20)17-12-8-7-9-13-17/h7-15,21H,5-6H2,1-4H3,(H,24,29)/t21-/m1/s1 |
| InChIKey | ZKMSOLQUYOKNIK-OAQYLSRUSA-N |
| XLogP | 4.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|