C18H31ClN2O2 — CID 119306401
(2S)-2-amino-N-[3-(2-ethylhexoxymethyl)phenyl]propanamide;hydrochloride (PubChem CID 119306401) has the molecular formula C18H31ClN2O2 and a molecular weight of 342.91 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(2-ethylhexoxymethyl)phenyl]propanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[3-(2-ethylhexoxymethyl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119306401 |
| Molecular Formula | C18H31ClN2O2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2S)-2-amino-N-[3-(2-ethylhexoxymethyl)phenyl]propanamide;hydrochloride |
| SMILES | CCCCC(CC)COCc1cccc(NC(=O)[C@H](C)N)c1.Cl |
| InChI | InChI=1S/C18H30N2O2.ClH/c1-4-6-8-15(5-2)12-22-13-16-9-7-10-17(11-16)20-18(21)14(3)19;/h7,9-11,14-15H,4-6,8,12-13,19H2,1-3H3,(H,20,21);1H/t14-,15?;/m0./s1 |
| InChIKey | SFDNXQNQXLFZNP-QDVCFFRGSA-N |
| XLogP | 4.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |