About N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide
N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide (PubChem CID 119308354) has the molecular formula C11H19F3N2O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide |
| PubChem CID | 119308354 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide |
| SMILES | CC(COCC(F)(F)F)NC(=O)C1CCCNC1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-8(6-18-7-11(12,13)14)16-10(17)9-3-2-4-15-5-9/h8-9,15H,2-7H2,1H3,(H,16,17) |
| InChIKey | ULEAZCBFGMBWSW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide?
The IUPAC name of N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide (CID 119308354) is N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide.
What is the SMILES notation for N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide?
The canonical SMILES for N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide is CC(COCC(F)(F)F)NC(=O)C1CCCNC1.
What is the InChIKey of N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide?
The InChIKey is ULEAZCBFGMBWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2/c1-8(6-18-7-11(12,13)14)16-10(17)9-3-2-4-15-5-9/h8-9,15H,2-7H2,1H3,(H,16,17).
What are the key properties of N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide?
N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide has a molecular weight of 268.28 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]piperidine-3-carboxamide is sourced from PubChem (CID 119308354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).