C17H27ClN2OS — CID 119309248
N-(4-butan-2-ylsulfanyl-2-methylphenyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119309248) has the molecular formula C17H27ClN2OS and a molecular weight of 342.94 g/mol. Its IUPAC name is N-(4-butan-2-ylsulfanyl-2-methylphenyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(4-butan-2-ylsulfanyl-2-methylphenyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119309248 |
| Molecular Formula | C17H27ClN2OS |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-(4-butan-2-ylsulfanyl-2-methylphenyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CCC(C)Sc1ccc(NC(=O)C2CCCNC2)c(C)c1.Cl |
| InChI | InChI=1S/C17H26N2OS.ClH/c1-4-13(3)21-15-7-8-16(12(2)10-15)19-17(20)14-6-5-9-18-11-14;/h7-8,10,13-14,18H,4-6,9,11H2,1-3H3,(H,19,20);1H |
| InChIKey | FFTORIIGLOWOEN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |