C13H25N3O2S — CID 119309564
(2S)-2-amino-N-[2-(cyclohexylamino)-2-oxoethyl]-4-methylsulfanylbutanamide (PubChem CID 119309564) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(cyclohexylamino)-2-oxoethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(cyclohexylamino)-2-oxoethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119309564 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2S)-2-amino-N-[2-(cyclohexylamino)-2-oxoethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-19-8-7-11(14)13(18)15-9-12(17)16-10-5-3-2-4-6-10/h10-11H,2-9,14H2,1H3,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | BFEKGQZEMRDOEE-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |